C23H25FIN3O4 — CID 175708608
tert-butyl 3-[4-ethyl-5-oxo-3-(phenylmethoxymethyl)-1,2,4-triazol-1-yl]-5-fluoro-2-iodobenzoate (PubChem CID 175708608) has the molecular formula C23H25FIN3O4 and a molecular weight of 553.37 g/mol. Its IUPAC name is tert-butyl 3-[4-ethyl-5-oxo-3-(phenylmethoxymethyl)-1,2,4-triazol-1-yl]-5-fluoro-2-iodobenzoate.
| Compound Name | tert-butyl 3-[4-ethyl-5-oxo-3-(phenylmethoxymethyl)-1,2,4-triazol-1-yl]-5-fluoro-2-iodobenzoate |
|---|---|
| PubChem CID | 175708608 |
| Molecular Formula | C23H25FIN3O4 |
| Molecular Weight | 553.37 g/mol |
| Exact Mass | 553.09 |
| IUPAC Name | tert-butyl 3-[4-ethyl-5-oxo-3-(phenylmethoxymethyl)-1,2,4-triazol-1-yl]-5-fluoro-2-iodobenzoate |
| SMILES | CCn1c(COCc2ccccc2)nn(-c2cc(F)cc(C(=O)OC(C)(C)C)c2I)c1=O |
| InChI | InChI=1S/C23H25FIN3O4/c1-5-27-19(14-31-13-15-9-7-6-8-10-15)26-28(22(27)30)18-12-16(24)11-17(20(18)25)21(29)32-23(2,3)4/h6-12H,5,13-14H2,1-4H3 |
| InChIKey | LQXNJAGBJLVTNI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|