C21H29N3O5 — CID 175709032
benzyl 2-[(2S)-1-[2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetyl]pyrrolidin-2-yl]-2-oxoacetate (PubChem CID 175709032) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is benzyl 2-[(2S)-1-[2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetyl]pyrrolidin-2-yl]-2-oxoacetate.
| Compound Name | benzyl 2-[(2S)-1-[2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetyl]pyrrolidin-2-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 175709032 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | benzyl 2-[(2S)-1-[2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetyl]pyrrolidin-2-yl]-2-oxoacetate |
| SMILES | CC(C)C[C@H](N)C(=O)NCC(=O)N1CCC[C@H]1C(=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29N3O5/c1-14(2)11-16(22)20(27)23-12-18(25)24-10-6-9-17(24)19(26)21(28)29-13-15-7-4-3-5-8-15/h3-5,7-8,14,16-17H,6,9-13,22H2,1-2H3,(H,23,27)/t16-,17-/m0/s1 |
| InChIKey | GEWPVPCQBZKLGI-IRXDYDNUSA-N |
| XLogP | 0.78 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|