About 6,7-difluoro-1,4-dihydroquinazoline
6,7-difluoro-1,4-dihydroquinazoline (PubChem CID 175709172) has the molecular formula C8H6F2N2
and a molecular weight of 168.15 g/mol. Its IUPAC name is 6,7-difluoro-1,4-dihydroquinazoline.
Molecular Properties
| Compound Name | 6,7-difluoro-1,4-dihydroquinazoline |
| PubChem CID | 175709172 |
| Molecular Formula | C8H6F2N2 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 6,7-difluoro-1,4-dihydroquinazoline |
| SMILES | Fc1cc2c(cc1F)NC=NC2 |
| InChI | InChI=1S/C8H6F2N2/c9-6-1-5-3-11-4-12-8(5)2-7(6)10/h1-2,4H,3H2,(H,11,12) |
| InChIKey | NVDZVKYGWGBGRP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-difluoro-1,4-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-difluoro-1,4-dihydroquinazoline?
The IUPAC name of 6,7-difluoro-1,4-dihydroquinazoline (CID 175709172) is 6,7-difluoro-1,4-dihydroquinazoline.
What is the SMILES notation for 6,7-difluoro-1,4-dihydroquinazoline?
The canonical SMILES for 6,7-difluoro-1,4-dihydroquinazoline is Fc1cc2c(cc1F)NC=NC2.
What is the InChIKey of 6,7-difluoro-1,4-dihydroquinazoline?
The InChIKey is NVDZVKYGWGBGRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F2N2/c9-6-1-5-3-11-4-12-8(5)2-7(6)10/h1-2,4H,3H2,(H,11,12).
What are the key properties of 6,7-difluoro-1,4-dihydroquinazoline?
6,7-difluoro-1,4-dihydroquinazoline has a molecular weight of 168.15 g/mol, XLogP of 1.92, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-difluoro-1,4-dihydroquinazoline is sourced from PubChem (CID 175709172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).