C23H30N2O2 — CID 175709457
3-[2-[(2S)-2-cyclobutyl-1,2,3,4-tetrahydrobenzo[b][1,8]naphthyridin-8-yl]ethyl]cyclopentane-1,2-diol (PubChem CID 175709457) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 3-[2-[(2S)-2-cyclobutyl-1,2,3,4-tetrahydrobenzo[b][1,8]naphthyridin-8-yl]ethyl]cyclopentane-1,2-diol.
| Compound Name | 3-[2-[(2S)-2-cyclobutyl-1,2,3,4-tetrahydrobenzo[b][1,8]naphthyridin-8-yl]ethyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 175709457 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 3-[2-[(2S)-2-cyclobutyl-1,2,3,4-tetrahydrobenzo[b][1,8]naphthyridin-8-yl]ethyl]cyclopentane-1,2-diol |
| SMILES | OC1CCC(CCc2ccc3cc4c(nc3c2)N[C@H](C2CCC2)CC4)C1O |
| InChI | InChI=1S/C23H30N2O2/c26-21-11-9-16(22(21)27)6-4-14-5-7-17-13-18-8-10-19(15-2-1-3-15)24-23(18)25-20(17)12-14/h5,7,12-13,15-16,19,21-22,26-27H,1-4,6,8-11H2,(H,24,25)/t16?,19-,21?,22?/m0/s1 |
| InChIKey | PGLZLJOKZAVLPX-CAWAVKPOSA-N |
| XLogP | 3.83 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |