About (Z)-but-2-enedioic acid;propylamino but-2-enoate
(Z)-but-2-enedioic acid;propylamino but-2-enoate (PubChem CID 175709555) has the molecular formula C11H17NO6
and a molecular weight of 259.26 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;propylamino but-2-enoate.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;propylamino but-2-enoate |
| PubChem CID | 175709555 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (Z)-but-2-enedioic acid;propylamino but-2-enoate |
| SMILES | CC=CC(=O)ONCCC.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C7H13NO2.C4H4O4/c1-3-5-7(9)10-8-6-4-2;5-3(6)1-2-4(7)8/h3,5,8H,4,6H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | HADNZEVTDXDSIW-BTJKTKAUSA-N |
| XLogP | 0.73 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;propylamino but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;propylamino but-2-enoate?
The IUPAC name of (Z)-but-2-enedioic acid;propylamino but-2-enoate (CID 175709555) is (Z)-but-2-enedioic acid;propylamino but-2-enoate.
What is the SMILES notation for (Z)-but-2-enedioic acid;propylamino but-2-enoate?
The canonical SMILES for (Z)-but-2-enedioic acid;propylamino but-2-enoate is CC=CC(=O)ONCCC.O=C(O)/C=C\C(=O)O.
What is the InChIKey of (Z)-but-2-enedioic acid;propylamino but-2-enoate?
The InChIKey is HADNZEVTDXDSIW-BTJKTKAUSA-N. The full InChI is InChI=1S/C7H13NO2.C4H4O4/c1-3-5-7(9)10-8-6-4-2;5-3(6)1-2-4(7)8/h3,5,8H,4,6H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of (Z)-but-2-enedioic acid;propylamino but-2-enoate?
(Z)-but-2-enedioic acid;propylamino but-2-enoate has a molecular weight of 259.26 g/mol, XLogP of 0.73, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;propylamino but-2-enoate is sourced from PubChem (CID 175709555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).