C16H18F2N4O — CID 175710455
(9R)-10,11-dideuterio-3-(difluoromethyl)-9-methyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one (PubChem CID 175710455) has the molecular formula C16H18F2N4O and a molecular weight of 322.36 g/mol. Its IUPAC name is (9R)-10,11-dideuterio-3-(difluoromethyl)-9-methyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one.
| Compound Name | (9R)-10,11-dideuterio-3-(difluoromethyl)-9-methyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
|---|---|
| PubChem CID | 175710455 |
| Molecular Formula | C16H18F2N4O |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (9R)-10,11-dideuterio-3-(difluoromethyl)-9-methyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
| SMILES | [2H]C1CCc2cc(ccn2)-c2c(cnn2C(F)F)NC(=O)[C@H](C)C1[2H] |
| InChI | InChI=1S/C16H18F2N4O/c1-10-4-2-3-5-12-8-11(6-7-19-12)14-13(21-15(10)23)9-20-22(14)16(17)18/h6-10,16H,2-5H2,1H3,(H,21,23)/t10-/m1/s1/i2D,4D/t2?,4?,10- |
| InChIKey | MPISZKWJZRFNFT-BFDPFPQVSA-N |
| XLogP | 3.64 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |