About bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide
bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide (PubChem CID 175710477) has the molecular formula C23H24N4O7S2
and a molecular weight of 532.60 g/mol. Its IUPAC name is bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide.
Molecular Properties
| Compound Name | bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide |
| PubChem CID | 175710477 |
| Molecular Formula | C23H24N4O7S2 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.NC(=O)c1ccccc1-n1ccnn1 |
| InChI | InChI=1S/C9H8N4O.2C7H8O3S/c10-9(14)7-3-1-2-4-8(7)13-6-5-11-12-13;2*1-6-2-4-7(5-3-6)11(8,9)10/h1-6H,(H2,10,14);2*2-5H,1H3,(H,8,9,10) |
| InChIKey | SLFCLZRPYIHUQX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 182.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide?
The IUPAC name of bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide (CID 175710477) is bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide.
What is the SMILES notation for bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide?
The canonical SMILES for bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide is Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.NC(=O)c1ccccc1-n1ccnn1.
What is the InChIKey of bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide?
The InChIKey is SLFCLZRPYIHUQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O.2C7H8O3S/c10-9(14)7-3-1-2-4-8(7)13-6-5-11-12-13;2*1-6-2-4-7(5-3-6)11(8,9)10/h1-6H,(H2,10,14);2*2-5H,1H3,(H,8,9,10).
What are the key properties of bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide?
bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide has a molecular weight of 532.60 g/mol, XLogP of 2.85, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-methylbenzenesulfonic acid);2-(triazol-1-yl)benzamide is sourced from PubChem (CID 175710477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).