About [1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol
[1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol (PubChem CID 175711075) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is [1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol.
Molecular Properties
| Compound Name | [1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol |
| PubChem CID | 175711075 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | [1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol |
| SMILES | CC(C)C1(C(C)C)CC(CO)(CO)C1 |
| InChI | InChI=1S/C12H24O2/c1-9(2)12(10(3)4)5-11(6-12,7-13)8-14/h9-10,13-14H,5-8H2,1-4H3 |
| InChIKey | NVDXMBYJESGNPE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol?
The IUPAC name of [1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol (CID 175711075) is [1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol.
What is the SMILES notation for [1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol?
The canonical SMILES for [1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol is CC(C)C1(C(C)C)CC(CO)(CO)C1.
What is the InChIKey of [1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol?
The InChIKey is NVDXMBYJESGNPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-9(2)12(10(3)4)5-11(6-12,7-13)8-14/h9-10,13-14H,5-8H2,1-4H3.
What are the key properties of [1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol?
[1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol has a molecular weight of 200.32 g/mol, XLogP of 2.05, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(hydroxymethyl)-3,3-di(propan-2-yl)cyclobutyl]methanol is sourced from PubChem (CID 175711075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).