C30H23ClF4N4O4S2 — CID 175711898
5-[[7-[5-chloro-1-[(4-fluoropiperidin-4-yl)methyl]indol-7-yl]thieno[3,2-b]pyridin-2-yl]methyl]thieno[3,4-c]pyrrole-4,6-dione;2,2,2-trifluoroacetic acid (PubChem CID 175711898) has the molecular formula C30H23ClF4N4O4S2 and a molecular weight of 679.12 g/mol. Its IUPAC name is 5-[[7-[5-chloro-1-[(4-fluoropiperidin-4-yl)methyl]indol-7-yl]thieno[3,2-b]pyridin-2-yl]methyl]thieno[3,4-c]pyrrole-4,6-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[[7-[5-chloro-1-[(4-fluoropiperidin-4-yl)methyl]indol-7-yl]thieno[3,2-b]pyridin-2-yl]methyl]thieno[3,4-c]pyrrole-4,6-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175711898 |
| Molecular Formula | C30H23ClF4N4O4S2 |
| Molecular Weight | 679.12 g/mol |
| Exact Mass | 678.08 |
| IUPAC Name | 5-[[7-[5-chloro-1-[(4-fluoropiperidin-4-yl)methyl]indol-7-yl]thieno[3,2-b]pyridin-2-yl]methyl]thieno[3,4-c]pyrrole-4,6-dione;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1c2cscc2C(=O)N1Cc1cc2nccc(-c3cc(Cl)cc4ccn(CC5(F)CCNCC5)c34)c2s1 |
| InChI | InChI=1S/C28H22ClFN4O2S2.C2HF3O2/c29-17-9-16-2-8-33(15-28(30)3-6-31-7-4-28)24(16)20(10-17)19-1-5-32-23-11-18(38-25(19)23)12-34-26(35)21-13-37-14-22(21)27(34)36;3-2(4,5)1(6)7/h1-2,5,8-11,13-14,31H,3-4,6-7,12,15H2;(H,6,7) |
| InChIKey | RVNYGIJAASZWML-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.12 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|