C42H36Br2 — CID 175712228
1,7-dibromo-4-[2-[4-[(3S)-3,7-dimethyloct-6-enyl]phenyl]phenyl]perylene (PubChem CID 175712228) has the molecular formula C42H36Br2 and a molecular weight of 700.56 g/mol. Its IUPAC name is 1,7-dibromo-4-[2-[4-[(3S)-3,7-dimethyloct-6-enyl]phenyl]phenyl]perylene.
| Compound Name | 1,7-dibromo-4-[2-[4-[(3S)-3,7-dimethyloct-6-enyl]phenyl]phenyl]perylene |
|---|---|
| PubChem CID | 175712228 |
| Molecular Formula | C42H36Br2 |
| Molecular Weight | 700.56 g/mol |
| Exact Mass | 698.12 |
| IUPAC Name | 1,7-dibromo-4-[2-[4-[(3S)-3,7-dimethyloct-6-enyl]phenyl]phenyl]perylene |
| SMILES | CC(C)=CCC[C@H](C)CCc1ccc(-c2ccccc2-c2ccc3c4c(Br)ccc5cccc(c6c(Br)ccc2c36)c54)cc1 |
| InChI | InChI=1S/C42H36Br2/c1-26(2)8-6-9-27(3)14-15-28-16-18-29(19-17-28)31-11-4-5-12-32(31)33-21-22-36-40-34(33)23-25-38(44)42(40)35-13-7-10-30-20-24-37(43)41(36)39(30)35/h4-5,7-8,10-13,16-25,27H,6,9,14-15H2,1-3H3/t27-/m0/s1 |
| InChIKey | WZZJQWGJHDQFFR-MHZLTWQESA-N |
| XLogP | 13.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.56 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|