C18F34 — CID 175712614
1,2-bis[1,1,1,3,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)hexan-2-yl]-3,3,4,4-tetrafluorocyclobutene (PubChem CID 175712614) has the molecular formula C18F34 and a molecular weight of 862.13 g/mol. Its IUPAC name is 1,2-bis[1,1,1,3,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)hexan-2-yl]-3,3,4,4-tetrafluorocyclobutene.
| Compound Name | 1,2-bis[1,1,1,3,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)hexan-2-yl]-3,3,4,4-tetrafluorocyclobutene |
|---|---|
| PubChem CID | 175712614 |
| Molecular Formula | C18F34 |
| Molecular Weight | 862.13 g/mol |
| Exact Mass | 861.95 |
| IUPAC Name | 1,2-bis[1,1,1,3,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)hexan-2-yl]-3,3,4,4-tetrafluorocyclobutene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C1=C(C(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C1(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18F34/c19-5(20)1(3(13(35,36)37,14(38,39)40)7(23,24)9(27,28)11(31,32)17(47,48)49)2(6(5,21)22)4(15(41,42)43,16(44,45)46)8(25,26)10(29,30)12(33,34)18(50,51)52 |
| InChIKey | CKVXPVFBWPUAHE-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.13 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|