C18H18N2O7 — CID 175712941
[1-(1,3-dioxoisoindol-2-yl)-3-(2,6-dioxopiperidin-1-yl)-2-methylpropan-2-yl] hydrogen carbonate (PubChem CID 175712941) has the molecular formula C18H18N2O7 and a molecular weight of 374.35 g/mol. Its IUPAC name is [1-(1,3-dioxoisoindol-2-yl)-3-(2,6-dioxopiperidin-1-yl)-2-methylpropan-2-yl] hydrogen carbonate.
| Compound Name | [1-(1,3-dioxoisoindol-2-yl)-3-(2,6-dioxopiperidin-1-yl)-2-methylpropan-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 175712941 |
| Molecular Formula | C18H18N2O7 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | [1-(1,3-dioxoisoindol-2-yl)-3-(2,6-dioxopiperidin-1-yl)-2-methylpropan-2-yl] hydrogen carbonate |
| SMILES | CC(CN1C(=O)CCCC1=O)(CN1C(=O)c2ccccc2C1=O)OC(=O)O |
| InChI | InChI=1S/C18H18N2O7/c1-18(27-17(25)26,9-19-13(21)7-4-8-14(19)22)10-20-15(23)11-5-2-3-6-12(11)16(20)24/h2-3,5-6H,4,7-10H2,1H3,(H,25,26) |
| InChIKey | TUQDRADNZBHTEK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|