C18H25N3OS — CID 175713134
tert-butyl-[(5-cyanospiro[1,3-dihydroindene-2,4'-piperidine]-1-yl)amino]-oxidosulfanium (PubChem CID 175713134) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is tert-butyl-[(5-cyanospiro[1,3-dihydroindene-2,4'-piperidine]-1-yl)amino]-oxidosulfanium.
| Compound Name | tert-butyl-[(5-cyanospiro[1,3-dihydroindene-2,4'-piperidine]-1-yl)amino]-oxidosulfanium |
|---|---|
| PubChem CID | 175713134 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | tert-butyl-[(5-cyanospiro[1,3-dihydroindene-2,4'-piperidine]-1-yl)amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])NC1c2ccc(C#N)cc2CC12CCNCC2 |
| InChI | InChI=1S/C18H25N3OS/c1-17(2,3)23(22)21-16-15-5-4-13(12-19)10-14(15)11-18(16)6-8-20-9-7-18/h4-5,10,16,20-21H,6-9,11H2,1-3H3 |
| InChIKey | IMDVIQVCSBVEJU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|