About 3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane
3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane (PubChem CID 175713182) has the molecular formula C9H16O3Si
and a molecular weight of 200.31 g/mol. Its IUPAC name is 3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane.
Molecular Properties
| Compound Name | 3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane |
| PubChem CID | 175713182 |
| Molecular Formula | C9H16O3Si |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane |
| SMILES | C=CC(C=C)(C=C)O[SiH](OC)OC |
| InChI | InChI=1S/C9H16O3Si/c1-6-9(7-2,8-3)12-13(10-4)11-5/h6-8,13H,1-3H2,4-5H3 |
| InChIKey | MHTUUORNMVYTIH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane?
The IUPAC name of 3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane (CID 175713182) is 3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane.
What is the SMILES notation for 3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane?
The canonical SMILES for 3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane is C=CC(C=C)(C=C)O[SiH](OC)OC.
What is the InChIKey of 3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane?
The InChIKey is MHTUUORNMVYTIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3Si/c1-6-9(7-2,8-3)12-13(10-4)11-5/h6-8,13H,1-3H2,4-5H3.
What are the key properties of 3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane?
3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane has a molecular weight of 200.31 g/mol, XLogP of 1.31, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenylpenta-1,4-dien-3-yloxy(dimethoxy)silane is sourced from PubChem (CID 175713182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).