C9H17NO6 — CID 175713443
butanedioic acid;[(2S)-1-hydroxypyrrolidin-2-yl]methanol (PubChem CID 175713443) has the molecular formula C9H17NO6 and a molecular weight of 235.24 g/mol. Its IUPAC name is butanedioic acid;[(2S)-1-hydroxypyrrolidin-2-yl]methanol.
| Compound Name | butanedioic acid;[(2S)-1-hydroxypyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 175713443 |
| Molecular Formula | C9H17NO6 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | butanedioic acid;[(2S)-1-hydroxypyrrolidin-2-yl]methanol |
| SMILES | O=C(O)CCC(=O)O.OC[C@@H]1CCCN1O |
| InChI | InChI=1S/C5H11NO2.C4H6O4/c7-4-5-2-1-3-6(5)8;5-3(6)1-2-4(7)8/h5,7-8H,1-4H2;1-2H2,(H,5,6)(H,7,8)/t5-;/m0./s1 |
| InChIKey | JLXCRTCHUBHEEH-JEDNCBNOSA-N |
| XLogP | -0.23 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |