1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid

C7H10N2O3 — CID 175713736

IUPAC1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid
SMILESO=C(O)C1CC2(CC=NO2)CN1
InChIInChI=1S/C7H10N2O3/c10-6(11)5-3-7(4-8-5)1-2-9-12-7/h2,5,8H,1,3-4H2,(H,10,11)
InChIKeyNXORVARNHDBIFY-UHFFFAOYSA-N
MW170.17 g/mol
LogP-0.42
Rot. Bonds1

About 1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid

1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid (PubChem CID 175713736) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid.

Molecular Properties

Compound Name1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid
PubChem CID175713736
Molecular FormulaC7H10N2O3
Molecular Weight170.17 g/mol
Exact Mass170.07
IUPAC Name1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid
SMILESO=C(O)C1CC2(CC=NO2)CN1
InChIInChI=1S/C7H10N2O3/c10-6(11)5-3-7(4-8-5)1-2-9-12-7/h2,5,8H,1,3-4H2,(H,10,11)
InChIKeyNXORVARNHDBIFY-UHFFFAOYSA-N
XLogP-0.42
TPSA70.92 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.17
LogP ≤ 5-0.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid?
The IUPAC name of 1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid (CID 175713736) is 1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid.
What is the SMILES notation for 1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid?
The canonical SMILES for 1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid is O=C(O)C1CC2(CC=NO2)CN1.
What is the InChIKey of 1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid?
The InChIKey is NXORVARNHDBIFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c10-6(11)5-3-7(4-8-5)1-2-9-12-7/h2,5,8H,1,3-4H2,(H,10,11).
What are the key properties of 1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid?
1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid has a molecular weight of 170.17 g/mol, XLogP of -0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxylic acid is sourced from PubChem (CID 175713736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).