C16H24O3 — CID 175713831
(1R,2R)-2-(2-methoxypropan-2-yloxymethyl)-2,6-dimethyl-1,3-dihydroinden-1-ol (PubChem CID 175713831) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (1R,2R)-2-(2-methoxypropan-2-yloxymethyl)-2,6-dimethyl-1,3-dihydroinden-1-ol.
| Compound Name | (1R,2R)-2-(2-methoxypropan-2-yloxymethyl)-2,6-dimethyl-1,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 175713831 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1R,2R)-2-(2-methoxypropan-2-yloxymethyl)-2,6-dimethyl-1,3-dihydroinden-1-ol |
| SMILES | COC(C)(C)OC[C@@]1(C)Cc2ccc(C)cc2[C@H]1O |
| InChI | InChI=1S/C16H24O3/c1-11-6-7-12-9-16(4,14(17)13(12)8-11)10-19-15(2,3)18-5/h6-8,14,17H,9-10H2,1-5H3/t14-,16-/m1/s1 |
| InChIKey | ZOSNOJIJPIHSNI-GDBMZVCRSA-N |
| XLogP | 2.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|