C9H8F3NO — CID 175713856
2,2,2-trifluoro-N-(6-methylcyclohexa-2,4-dien-1-ylidene)acetamide (PubChem CID 175713856) has the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(6-methylcyclohexa-2,4-dien-1-ylidene)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(6-methylcyclohexa-2,4-dien-1-ylidene)acetamide |
|---|---|
| PubChem CID | 175713856 |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2,2,2-trifluoro-N-(6-methylcyclohexa-2,4-dien-1-ylidene)acetamide |
| SMILES | CC1C=CC=C/C1=N\C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H8F3NO/c1-6-4-2-3-5-7(6)13-8(14)9(10,11)12/h2-6H,1H3/b13-7+ |
| InChIKey | YAVWXRFBTXSSIJ-NTUHNPAUSA-N |
| XLogP | 2.28 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|