About 6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc
6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc (PubChem CID 175714061) has the molecular formula C5H7N3O2Zn
and a molecular weight of 206.52 g/mol. Its IUPAC name is 6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc.
Molecular Properties
| Compound Name | 6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc |
| PubChem CID | 175714061 |
| Molecular Formula | C5H7N3O2Zn |
| Molecular Weight | 206.52 g/mol |
| Exact Mass | 204.98 |
| IUPAC Name | 6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc |
| SMILES | Nc1[nH]c(=O)ncc1CO.[Zn] |
| InChI | InChI=1S/C5H7N3O2.Zn/c6-4-3(2-9)1-7-5(10)8-4;/h1,9H,2H2,(H3,6,7,8,10); |
| InChIKey | HSYSSZACCNCNHN-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.52 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc?
The IUPAC name of 6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc (CID 175714061) is 6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc.
What is the SMILES notation for 6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc?
The canonical SMILES for 6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc is Nc1[nH]c(=O)ncc1CO.[Zn].
What is the InChIKey of 6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc?
The InChIKey is HSYSSZACCNCNHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2.Zn/c6-4-3(2-9)1-7-5(10)8-4;/h1,9H,2H2,(H3,6,7,8,10);.
What are the key properties of 6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc?
6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc has a molecular weight of 206.52 g/mol, XLogP of -1.16, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-(hydroxymethyl)-1H-pyrimidin-2-one;zinc is sourced from PubChem (CID 175714061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).