About 2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide
2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide (PubChem CID 175714123) has the molecular formula C6H12N2O4S3
and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide.
Molecular Properties
| Compound Name | 2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide |
| PubChem CID | 175714123 |
| Molecular Formula | C6H12N2O4S3 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide |
| SMILES | CNS(=O)(=O)C1(C)CC=C(S(N)(=O)=O)S1 |
| InChI | InChI=1S/C6H12N2O4S3/c1-6(15(11,12)8-2)4-3-5(13-6)14(7,9)10/h3,8H,4H2,1-2H3,(H2,7,9,10) |
| InChIKey | LOUXFXWOXSUXFB-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide?
The IUPAC name of 2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide (CID 175714123) is 2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide.
What is the SMILES notation for 2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide?
The canonical SMILES for 2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide is CNS(=O)(=O)C1(C)CC=C(S(N)(=O)=O)S1.
What is the InChIKey of 2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide?
The InChIKey is LOUXFXWOXSUXFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O4S3/c1-6(15(11,12)8-2)4-3-5(13-6)14(7,9)10/h3,8H,4H2,1-2H3,(H2,7,9,10).
What are the key properties of 2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide?
2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide has a molecular weight of 272.37 g/mol, XLogP of -0.48, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-dimethyl-3H-thiophene-2,5-disulfonamide is sourced from PubChem (CID 175714123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).