C9H9LiNO2 — CID 175714264
CID 175714264 (PubChem CID 175714264) has the molecular formula C9H9LiNO2 and a molecular weight of 170.12 g/mol.
| Compound Name | CID 175714264 |
|---|---|
| PubChem CID | 175714264 |
| Molecular Formula | C9H9LiNO2 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | — |
| SMILES | O=C(O)c1cccc(C2CC2)n1.[Li] |
| InChI | InChI=1S/C9H9NO2.Li/c11-9(12)8-3-1-2-7(10-8)6-4-5-6;/h1-3,6H,4-5H2,(H,11,12); |
| InChIKey | RRMNFOFEKXLYQH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |