C25H19FN4O3 — CID 175714440
2-[4-[[4-(4-fluorophenyl)-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoic acid (PubChem CID 175714440) has the molecular formula C25H19FN4O3 and a molecular weight of 442.45 g/mol. Its IUPAC name is 2-[4-[[4-(4-fluorophenyl)-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoic acid.
| Compound Name | 2-[4-[[4-(4-fluorophenyl)-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175714440 |
| Molecular Formula | C25H19FN4O3 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-[4-[[4-(4-fluorophenyl)-6-(4-methoxyphenyl)-1,3,5-triazin-2-yl]amino]phenyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1ccc(Nc2nc(-c3ccc(F)cc3)nc(-c3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C25H19FN4O3/c1-15(24(31)32)16-5-11-20(12-6-16)27-25-29-22(17-3-9-19(26)10-4-17)28-23(30-25)18-7-13-21(33-2)14-8-18/h3-14H,1H2,2H3,(H,31,32)(H,27,28,29,30) |
| InChIKey | YGGVVVXBDCUOQB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|