C25H45BN2O5Si2 — CID 175715318
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-bis(2-trimethylsilylethoxymethyl)benzimidazol-2-one (PubChem CID 175715318) has the molecular formula C25H45BN2O5Si2 and a molecular weight of 520.63 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-bis(2-trimethylsilylethoxymethyl)benzimidazol-2-one.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-bis(2-trimethylsilylethoxymethyl)benzimidazol-2-one |
|---|---|
| PubChem CID | 175715318 |
| Molecular Formula | C25H45BN2O5Si2 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-bis(2-trimethylsilylethoxymethyl)benzimidazol-2-one |
| SMILES | CC1(C)OB(c2cccc3c2n(COCC[Si](C)(C)C)c(=O)n3COCC[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C25H45BN2O5Si2/c1-24(2)25(3,4)33-26(32-24)20-12-11-13-21-22(20)28(19-31-15-17-35(8,9)10)23(29)27(21)18-30-14-16-34(5,6)7/h11-13H,14-19H2,1-10H3 |
| InChIKey | UFNLLGXRGVLCJA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|