C40H30N4 — CID 175716577
1-methyl-2-[3-[3-[3-(1-methylbenzimidazol-2-yl)phenyl]-4-phenylphenyl]phenyl]benzimidazole (PubChem CID 175716577) has the molecular formula C40H30N4 and a molecular weight of 566.71 g/mol. Its IUPAC name is 1-methyl-2-[3-[3-[3-(1-methylbenzimidazol-2-yl)phenyl]-4-phenylphenyl]phenyl]benzimidazole.
| Compound Name | 1-methyl-2-[3-[3-[3-(1-methylbenzimidazol-2-yl)phenyl]-4-phenylphenyl]phenyl]benzimidazole |
|---|---|
| PubChem CID | 175716577 |
| Molecular Formula | C40H30N4 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 1-methyl-2-[3-[3-[3-(1-methylbenzimidazol-2-yl)phenyl]-4-phenylphenyl]phenyl]benzimidazole |
| SMILES | Cn1c(-c2cccc(-c3ccc(-c4ccccc4)c(-c4cccc(-c5nc6ccccc6n5C)c4)c3)c2)nc2ccccc21 |
| InChI | InChI=1S/C40H30N4/c1-43-37-20-8-6-18-35(37)41-39(43)31-16-10-14-28(24-31)29-22-23-33(27-12-4-3-5-13-27)34(26-29)30-15-11-17-32(25-30)40-42-36-19-7-9-21-38(36)44(40)2/h3-26H,1-2H3 |
| InChIKey | UVSGGEKGMBFIDY-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |