C31H38N2O10 — CID 175717338
(1R,2R,3R,3aR,8bS)-2-amino-6-(4-aminobutoxy)-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol;formic acid (PubChem CID 175717338) has the molecular formula C31H38N2O10 and a molecular weight of 598.65 g/mol. Its IUPAC name is (1R,2R,3R,3aR,8bS)-2-amino-6-(4-aminobutoxy)-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol;formic acid.
| Compound Name | (1R,2R,3R,3aR,8bS)-2-amino-6-(4-aminobutoxy)-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol;formic acid |
|---|---|
| PubChem CID | 175717338 |
| Molecular Formula | C31H38N2O10 |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | (1R,2R,3R,3aR,8bS)-2-amino-6-(4-aminobutoxy)-8-methoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1,8b-diol;formic acid |
| SMILES | COc1ccc([C@@]23Oc4cc(OCCCCN)cc(OC)c4[C@]2(O)[C@H](O)[C@H](N)[C@H]3c2ccccc2)cc1.O=CO.O=CO |
| InChI | InChI=1S/C29H34N2O6.2CH2O2/c1-34-20-12-10-19(11-13-20)29-24(18-8-4-3-5-9-18)26(31)27(32)28(29,33)25-22(35-2)16-21(17-23(25)37-29)36-15-7-6-14-30;2*2-1-3/h3-5,8-13,16-17,24,26-27,32-33H,6-7,14-15,30-31H2,1-2H3;2*1H,(H,2,3)/t24-,26-,27-,28+,29+;;/m1../s1 |
| InChIKey | GCDHZFBMJCLGKJ-LZXNXJMTSA-N |
| XLogP | 2.18 |
| TPSA | 204.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|