C29H32F3N5O2 — CID 175717348
4-N-[(1R)-1-[4-[(4-cyclopropyl-1,5-naphthyridin-3-yl)amino]phenyl]-2,2,2-trifluoroethyl]-1-N,4-N-dimethylcyclohexane-1,4-dicarboxamide (PubChem CID 175717348) has the molecular formula C29H32F3N5O2 and a molecular weight of 539.60 g/mol. Its IUPAC name is 4-N-[(1R)-1-[4-[(4-cyclopropyl-1,5-naphthyridin-3-yl)amino]phenyl]-2,2,2-trifluoroethyl]-1-N,4-N-dimethylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-[(1R)-1-[4-[(4-cyclopropyl-1,5-naphthyridin-3-yl)amino]phenyl]-2,2,2-trifluoroethyl]-1-N,4-N-dimethylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 175717348 |
| Molecular Formula | C29H32F3N5O2 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 4-N-[(1R)-1-[4-[(4-cyclopropyl-1,5-naphthyridin-3-yl)amino]phenyl]-2,2,2-trifluoroethyl]-1-N,4-N-dimethylcyclohexane-1,4-dicarboxamide |
| SMILES | CNC(=O)C1CCC(C(=O)N(C)[C@H](c2ccc(Nc3cnc4cccnc4c3C3CC3)cc2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C29H32F3N5O2/c1-33-27(38)19-7-9-20(10-8-19)28(39)37(2)26(29(30,31)32)18-11-13-21(14-12-18)36-23-16-35-22-4-3-15-34-25(22)24(23)17-5-6-17/h3-4,11-17,19-20,26,36H,5-10H2,1-2H3,(H,33,38)/t19?,20?,26-/m1/s1 |
| InChIKey | NNFQKLTYZFWGOO-XYVRPBRGSA-N |
| XLogP | 5.86 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |