About 5-(3-fluorocyclobutyl)-1,2-dihydropyridine
5-(3-fluorocyclobutyl)-1,2-dihydropyridine (PubChem CID 175717532) has the molecular formula C9H12FN
and a molecular weight of 153.20 g/mol. Its IUPAC name is 5-(3-fluorocyclobutyl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 5-(3-fluorocyclobutyl)-1,2-dihydropyridine |
| PubChem CID | 175717532 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 5-(3-fluorocyclobutyl)-1,2-dihydropyridine |
| SMILES | FC1CC(C2=CNCC=C2)C1 |
| InChI | InChI=1S/C9H12FN/c10-9-4-8(5-9)7-2-1-3-11-6-7/h1-2,6,8-9,11H,3-5H2 |
| InChIKey | WCYURDHMHDACCT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(3-fluorocyclobutyl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-fluorocyclobutyl)-1,2-dihydropyridine?
The IUPAC name of 5-(3-fluorocyclobutyl)-1,2-dihydropyridine (CID 175717532) is 5-(3-fluorocyclobutyl)-1,2-dihydropyridine.
What is the SMILES notation for 5-(3-fluorocyclobutyl)-1,2-dihydropyridine?
The canonical SMILES for 5-(3-fluorocyclobutyl)-1,2-dihydropyridine is FC1CC(C2=CNCC=C2)C1.
What is the InChIKey of 5-(3-fluorocyclobutyl)-1,2-dihydropyridine?
The InChIKey is WCYURDHMHDACCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN/c10-9-4-8(5-9)7-2-1-3-11-6-7/h1-2,6,8-9,11H,3-5H2.
What are the key properties of 5-(3-fluorocyclobutyl)-1,2-dihydropyridine?
5-(3-fluorocyclobutyl)-1,2-dihydropyridine has a molecular weight of 153.20 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluorocyclobutyl)-1,2-dihydropyridine is sourced from PubChem (CID 175717532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).