About tetrasodium;carbonic acid;silicate
tetrasodium;carbonic acid;silicate (PubChem CID 175718379) has the molecular formula CH2Na4O7Si
and a molecular weight of 246.07 g/mol. Its IUPAC name is tetrasodium;carbonic acid;silicate.
Molecular Properties
| Compound Name | tetrasodium;carbonic acid;silicate |
| PubChem CID | 175718379 |
| Molecular Formula | CH2Na4O7Si |
| Molecular Weight | 246.07 g/mol |
| Exact Mass | 245.92 |
| IUPAC Name | tetrasodium;carbonic acid;silicate |
| SMILES | O=C(O)O.[Na+].[Na+].[Na+].[Na+].[O-][Si]([O-])([O-])[O-] |
| InChI | InChI=1S/CH2O3.4Na.O4Si/c2-1(3)4;;;;;1-5(2,3)4/h(H2,2,3,4);;;;;/q;4*+1;-4 |
| InChIKey | TVHQXVDUAZUSMZ-UHFFFAOYSA-N |
| XLogP | -16.90 |
| TPSA | 149.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.07 |
| LogP ≤ 5 | -16.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetrasodium;carbonic acid;silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrasodium;carbonic acid;silicate?
The IUPAC name of tetrasodium;carbonic acid;silicate (CID 175718379) is tetrasodium;carbonic acid;silicate.
What is the SMILES notation for tetrasodium;carbonic acid;silicate?
The canonical SMILES for tetrasodium;carbonic acid;silicate is O=C(O)O.[Na+].[Na+].[Na+].[Na+].[O-][Si]([O-])([O-])[O-].
What is the InChIKey of tetrasodium;carbonic acid;silicate?
The InChIKey is TVHQXVDUAZUSMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.4Na.O4Si/c2-1(3)4;;;;;1-5(2,3)4/h(H2,2,3,4);;;;;/q;4*+1;-4.
What are the key properties of tetrasodium;carbonic acid;silicate?
tetrasodium;carbonic acid;silicate has a molecular weight of 246.07 g/mol, XLogP of -16.90, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tetrasodium;carbonic acid;silicate is sourced from PubChem (CID 175718379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).