(2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid

C5H13N3O2 — CID 175718483

IUPAC(2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid
SMILESCC(C)[C@@](N)(NN)C(=O)O
InChIInChI=1S/C5H13N3O2/c1-3(2)5(6,8-7)4(9)10/h3,8H,6-7H2,1-2H3,(H,9,10)/t5-/m1/s1
InChIKeySVYHOLHOJLMIKL-RXMQYKEDSA-N
MW147.18 g/mol
LogP-1.15
Rot. Bonds3

About (2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid

(2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid (PubChem CID 175718483) has the molecular formula C5H13N3O2 and a molecular weight of 147.18 g/mol. Its IUPAC name is (2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid.

Molecular Properties

Compound Name(2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid
PubChem CID175718483
Molecular FormulaC5H13N3O2
Molecular Weight147.18 g/mol
Exact Mass147.10
IUPAC Name(2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid
SMILESCC(C)[C@@](N)(NN)C(=O)O
InChIInChI=1S/C5H13N3O2/c1-3(2)5(6,8-7)4(9)10/h3,8H,6-7H2,1-2H3,(H,9,10)/t5-/m1/s1
InChIKeySVYHOLHOJLMIKL-RXMQYKEDSA-N
XLogP-1.15
TPSA101.37 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500147.18
LogP ≤ 5-1.15
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-amino-2-hydroxy-3-methylbutanoic acid
CID 5320350
(2S)-2-amino-4-deuterio-2,3-dimethylbutanoic acid
CID 141141472
2-acetyl-2-amino-3-methylbutanoic acid
CID 18917748
(2S)-2-amino-2-ethyl-3-methylbutanoic acid
CID 54561958
potassium;carbonic acid;hydride;2,3,4-trimethylpentan-3-amine
CID 174931544
(2S)-2-amino-2-(2-fluoroethyl)-3-methylbutanoic acid
CID 125427224
2-hydrazinyl-2,3-dihydroxybutanedioic acid
CID 141106740
2,2-diamino-3-methyl-4-oxopentanoic acid
CID 23065100
1-hydrazinylethanol;oxalic acid
CID 174529784
CID 86589108
CID 86589108
2-fluoro-2-methoxy-3-methylbutanoic acid
CID 89358566
acetic acid;2-amino-2-propan-2-ylpropane-1,3-diol
CID 86741967

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid?
The IUPAC name of (2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid (CID 175718483) is (2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid.
What is the SMILES notation for (2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid?
The canonical SMILES for (2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid is CC(C)[C@@](N)(NN)C(=O)O.
What is the InChIKey of (2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid?
The InChIKey is SVYHOLHOJLMIKL-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H13N3O2/c1-3(2)5(6,8-7)4(9)10/h3,8H,6-7H2,1-2H3,(H,9,10)/t5-/m1/s1.
What are the key properties of (2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid?
(2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid has a molecular weight of 147.18 g/mol, XLogP of -1.15, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-2-hydrazinyl-3-methylbutanoic acid is sourced from PubChem (CID 175718483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).