About (2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid
(2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid (PubChem CID 175718537) has the molecular formula C8H12N4O3
and a molecular weight of 212.21 g/mol. Its IUPAC name is (2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid.
Molecular Properties
| Compound Name | (2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid |
| PubChem CID | 175718537 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@H](NC1=CC=NCN1)C(=O)O |
| InChI | InChI=1S/C8H12N4O3/c9-6(13)3-5(8(14)15)12-7-1-2-10-4-11-7/h1-2,5,11-12H,3-4H2,(H2,9,13)(H,14,15)/t5-/m0/s1 |
| InChIKey | FHYWIXQTIJJWMF-YFKPBYRVSA-N |
| XLogP | -1.62 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid?
The IUPAC name of (2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid (CID 175718537) is (2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid.
What is the SMILES notation for (2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid?
The canonical SMILES for (2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid is NC(=O)C[C@H](NC1=CC=NCN1)C(=O)O.
What is the InChIKey of (2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid?
The InChIKey is FHYWIXQTIJJWMF-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H12N4O3/c9-6(13)3-5(8(14)15)12-7-1-2-10-4-11-7/h1-2,5,11-12H,3-4H2,(H2,9,13)(H,14,15)/t5-/m0/s1.
What are the key properties of (2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid?
(2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid has a molecular weight of 212.21 g/mol, XLogP of -1.62, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-amino-2-(1,2-dihydropyrimidin-6-ylamino)-4-oxobutanoic acid is sourced from PubChem (CID 175718537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).