About palladium(2+);2-phenylaniline
palladium(2+);2-phenylaniline (PubChem CID 175718665) has the molecular formula C12H11NPd+2
and a molecular weight of 275.65 g/mol. Its IUPAC name is palladium(2+);2-phenylaniline.
Molecular Properties
| Compound Name | palladium(2+);2-phenylaniline |
| PubChem CID | 175718665 |
| Molecular Formula | C12H11NPd+2 |
| Molecular Weight | 275.65 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | palladium(2+);2-phenylaniline |
| SMILES | Nc1ccccc1-c1ccccc1.[Pd+2] |
| InChI | InChI=1S/C12H11N.Pd/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9H,13H2;/q;+2 |
| InChIKey | SHNYJWJITPQFED-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.65 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze palladium(2+);2-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium(2+);2-phenylaniline?
The IUPAC name of palladium(2+);2-phenylaniline (CID 175718665) is palladium(2+);2-phenylaniline.
What is the SMILES notation for palladium(2+);2-phenylaniline?
The canonical SMILES for palladium(2+);2-phenylaniline is Nc1ccccc1-c1ccccc1.[Pd+2].
What is the InChIKey of palladium(2+);2-phenylaniline?
The InChIKey is SHNYJWJITPQFED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.Pd/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9H,13H2;/q;+2.
What are the key properties of palladium(2+);2-phenylaniline?
palladium(2+);2-phenylaniline has a molecular weight of 275.65 g/mol, XLogP of 2.93, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for palladium(2+);2-phenylaniline is sourced from PubChem (CID 175718665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).