C20H34O2 — CID 175719785
[(2E)-3,7-dimethylocta-2,6-dienyl] 3,7-dimethyloct-6-enoate (PubChem CID 175719785) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] 3,7-dimethyloct-6-enoate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 3,7-dimethyloct-6-enoate |
|---|---|
| PubChem CID | 175719785 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 3,7-dimethyloct-6-enoate |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)CC(C)CCC=C(C)C |
| InChI | InChI=1S/C20H34O2/c1-16(2)9-7-11-18(5)13-14-22-20(21)15-19(6)12-8-10-17(3)4/h9-10,13,19H,7-8,11-12,14-15H2,1-6H3/b18-13+ |
| InChIKey | DQNDYKIKXIXVJN-QGOAFFKASA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|