About 3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron
3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron (PubChem CID 175719967) has the molecular formula C13H22FeNO2Si-
and a molecular weight of 308.25 g/mol. Its IUPAC name is 3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron.
Molecular Properties
| Compound Name | 3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron |
| PubChem CID | 175719967 |
| Molecular Formula | C13H22FeNO2Si- |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron |
| SMILES | CC[CH-][Si](C)(C)OCCOc1cccc(N)c1.[Fe] |
| InChI | InChI=1S/C13H22NO2Si.Fe/c1-4-10-17(2,3)16-9-8-15-13-7-5-6-12(14)11-13;/h5-7,10-11H,4,8-9,14H2,1-3H3;/q-1; |
| InChIKey | FQFBIPRKMBGIFO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron?
The IUPAC name of 3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron (CID 175719967) is 3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron.
What is the SMILES notation for 3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron?
The canonical SMILES for 3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron is CC[CH-][Si](C)(C)OCCOc1cccc(N)c1.[Fe].
What is the InChIKey of 3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron?
The InChIKey is FQFBIPRKMBGIFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22NO2Si.Fe/c1-4-10-17(2,3)16-9-8-15-13-7-5-6-12(14)11-13;/h5-7,10-11H,4,8-9,14H2,1-3H3;/q-1;.
What are the key properties of 3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron?
3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron has a molecular weight of 308.25 g/mol, XLogP of 3.02, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[dimethyl(propyl)silyl]oxyethoxy]aniline;iron is sourced from PubChem (CID 175719967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).