About 3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline
3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline (PubChem CID 175719996) has the molecular formula C14H9BrF2N2
and a molecular weight of 323.14 g/mol. Its IUPAC name is 3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline.
Molecular Properties
| Compound Name | 3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline |
| PubChem CID | 175719996 |
| Molecular Formula | C14H9BrF2N2 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline |
| SMILES | Fc1ccc(Br)c(F)c1N1C=Nc2ccccc2C1 |
| InChI | InChI=1S/C14H9BrF2N2/c15-10-5-6-11(16)14(13(10)17)19-7-9-3-1-2-4-12(9)18-8-19/h1-6,8H,7H2 |
| InChIKey | APSGZJLYNDVIGC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline?
The IUPAC name of 3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline (CID 175719996) is 3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline.
What is the SMILES notation for 3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline?
The canonical SMILES for 3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline is Fc1ccc(Br)c(F)c1N1C=Nc2ccccc2C1.
What is the InChIKey of 3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline?
The InChIKey is APSGZJLYNDVIGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BrF2N2/c15-10-5-6-11(16)14(13(10)17)19-7-9-3-1-2-4-12(9)18-8-19/h1-6,8H,7H2.
What are the key properties of 3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline?
3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline has a molecular weight of 323.14 g/mol, XLogP of 4.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromo-2,6-difluorophenyl)-4H-quinazoline is sourced from PubChem (CID 175719996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).