C17H26F3N5O — CID 175722072
2-methylpropan-2-amine;1-[2-(2H-tetrazol-5-yl)-4-(trifluoromethyl)phenyl]pentan-1-ol (PubChem CID 175722072) has the molecular formula C17H26F3N5O and a molecular weight of 373.42 g/mol. Its IUPAC name is 2-methylpropan-2-amine;1-[2-(2H-tetrazol-5-yl)-4-(trifluoromethyl)phenyl]pentan-1-ol.
| Compound Name | 2-methylpropan-2-amine;1-[2-(2H-tetrazol-5-yl)-4-(trifluoromethyl)phenyl]pentan-1-ol |
|---|---|
| PubChem CID | 175722072 |
| Molecular Formula | C17H26F3N5O |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 2-methylpropan-2-amine;1-[2-(2H-tetrazol-5-yl)-4-(trifluoromethyl)phenyl]pentan-1-ol |
| SMILES | CC(C)(C)N.CCCCC(O)c1ccc(C(F)(F)F)cc1-c1nn[nH]n1 |
| InChI | InChI=1S/C13H15F3N4O.C4H11N/c1-2-3-4-11(21)9-6-5-8(13(14,15)16)7-10(9)12-17-19-20-18-12;1-4(2,3)5/h5-7,11,21H,2-4H2,1H3,(H,17,18,19,20);5H2,1-3H3 |
| InChIKey | IZUUPYCTWWXURQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |