About 5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole
5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole (PubChem CID 175723831) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is 5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole.
Molecular Properties
| Compound Name | 5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole |
| PubChem CID | 175723831 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole |
| SMILES | Cc1ccc2c(c1)NN(c1ccccc1)O2 |
| InChI | InChI=1S/C13H12N2O/c1-10-7-8-13-12(9-10)14-15(16-13)11-5-3-2-4-6-11/h2-9,14H,1H3 |
| InChIKey | MSSPQAAGCGDOES-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole?
The IUPAC name of 5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole (CID 175723831) is 5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole.
What is the SMILES notation for 5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole?
The canonical SMILES for 5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole is Cc1ccc2c(c1)NN(c1ccccc1)O2.
What is the InChIKey of 5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole?
The InChIKey is MSSPQAAGCGDOES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O/c1-10-7-8-13-12(9-10)14-15(16-13)11-5-3-2-4-6-11/h2-9,14H,1H3.
What are the key properties of 5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole?
5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole has a molecular weight of 212.25 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-phenyl-3H-1,2,3-benzoxadiazole is sourced from PubChem (CID 175723831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).