C16H10F3N3O2 — CID 175723904
pyrazolo[1,5-a]pyridine-3-carbonitrile;2-(2,3,4-trifluorophenyl)acetic acid (PubChem CID 175723904) has the molecular formula C16H10F3N3O2 and a molecular weight of 333.27 g/mol. Its IUPAC name is pyrazolo[1,5-a]pyridine-3-carbonitrile;2-(2,3,4-trifluorophenyl)acetic acid.
| Compound Name | pyrazolo[1,5-a]pyridine-3-carbonitrile;2-(2,3,4-trifluorophenyl)acetic acid |
|---|---|
| PubChem CID | 175723904 |
| Molecular Formula | C16H10F3N3O2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | pyrazolo[1,5-a]pyridine-3-carbonitrile;2-(2,3,4-trifluorophenyl)acetic acid |
| SMILES | N#Cc1cnn2ccccc12.O=C(O)Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C8H5F3O2.C8H5N3/c9-5-2-1-4(3-6(12)13)7(10)8(5)11;9-5-7-6-10-11-4-2-1-3-8(7)11/h1-2H,3H2,(H,12,13);1-4,6H |
| InChIKey | YRFRNOBJJCUJSP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|