C20H25N5O4 — CID 175724776
tert-butyl 4,9-dimethyl-8,11-dioxo-2,5,9,12,14-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13(18),14,16-tetraene-5-carboxylate (PubChem CID 175724776) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is tert-butyl 4,9-dimethyl-8,11-dioxo-2,5,9,12,14-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13(18),14,16-tetraene-5-carboxylate.
| Compound Name | tert-butyl 4,9-dimethyl-8,11-dioxo-2,5,9,12,14-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13(18),14,16-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 175724776 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | tert-butyl 4,9-dimethyl-8,11-dioxo-2,5,9,12,14-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13(18),14,16-tetraene-5-carboxylate |
| SMILES | CC1CN2c3c(c(=O)[nH]c4ncccc34)N(C)C(=O)C2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H25N5O4/c1-11-9-25-13(10-24(11)19(28)29-20(2,3)4)18(27)23(5)15-14(25)12-7-6-8-21-16(12)22-17(15)26/h6-8,11,13H,9-10H2,1-5H3,(H,21,22,26) |
| InChIKey | NYNLGUQYJWMYCK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |