C21H21N3O2 — CID 175725105
methyl 2-[[benzyl(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carboxylate (PubChem CID 175725105) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is methyl 2-[[benzyl(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carboxylate.
| Compound Name | methyl 2-[[benzyl(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 175725105 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | methyl 2-[[benzyl(pyridin-2-ylmethyl)amino]methyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1CN(Cc1ccccc1)Cc1ccccn1 |
| InChI | InChI=1S/C21H21N3O2/c1-26-21(25)19-11-7-13-23-20(19)16-24(14-17-8-3-2-4-9-17)15-18-10-5-6-12-22-18/h2-13H,14-16H2,1H3 |
| InChIKey | GQPFFLPOKPBPJX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |