About 7-cyclopropyl-4H-1,3-benzodioxine
7-cyclopropyl-4H-1,3-benzodioxine (PubChem CID 175725271) has the molecular formula C11H12O2
and a molecular weight of 176.21 g/mol. Its IUPAC name is 7-cyclopropyl-4H-1,3-benzodioxine.
Molecular Properties
| Compound Name | 7-cyclopropyl-4H-1,3-benzodioxine |
| PubChem CID | 175725271 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 7-cyclopropyl-4H-1,3-benzodioxine |
| SMILES | c1cc2c(cc1C1CC1)OCOC2 |
| InChI | InChI=1S/C11H12O2/c1-2-8(1)9-3-4-10-6-12-7-13-11(10)5-9/h3-5,8H,1-2,6-7H2 |
| InChIKey | YSLGEFGJRRQVBM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-cyclopropyl-4H-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclopropyl-4H-1,3-benzodioxine?
The IUPAC name of 7-cyclopropyl-4H-1,3-benzodioxine (CID 175725271) is 7-cyclopropyl-4H-1,3-benzodioxine.
What is the SMILES notation for 7-cyclopropyl-4H-1,3-benzodioxine?
The canonical SMILES for 7-cyclopropyl-4H-1,3-benzodioxine is c1cc2c(cc1C1CC1)OCOC2.
What is the InChIKey of 7-cyclopropyl-4H-1,3-benzodioxine?
The InChIKey is YSLGEFGJRRQVBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-2-8(1)9-3-4-10-6-12-7-13-11(10)5-9/h3-5,8H,1-2,6-7H2.
What are the key properties of 7-cyclopropyl-4H-1,3-benzodioxine?
7-cyclopropyl-4H-1,3-benzodioxine has a molecular weight of 176.21 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclopropyl-4H-1,3-benzodioxine is sourced from PubChem (CID 175725271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).