About 2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+)
2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+) (PubChem CID 175725412) has the molecular formula C12H22O3Ti+3
and a molecular weight of 262.17 g/mol. Its IUPAC name is 2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+).
Molecular Properties
| Compound Name | 2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+) |
| PubChem CID | 175725412 |
| Molecular Formula | C12H22O3Ti+3 |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+) |
| SMILES | C=CCOCC(CC)(CO)COCC=C.[Ti+3] |
| InChI | InChI=1S/C12H22O3.Ti/c1-4-7-14-10-12(6-3,9-13)11-15-8-5-2;/h4-5,13H,1-2,6-11H2,3H3;/q;+3 |
| InChIKey | OJYZMBGDNHBCCC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+)?
The IUPAC name of 2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+) (CID 175725412) is 2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+).
What is the SMILES notation for 2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+)?
The canonical SMILES for 2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+) is C=CCOCC(CC)(CO)COCC=C.[Ti+3].
What is the InChIKey of 2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+)?
The InChIKey is OJYZMBGDNHBCCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3.Ti/c1-4-7-14-10-12(6-3,9-13)11-15-8-5-2;/h4-5,13H,1-2,6-11H2,3H3;/q;+3.
What are the key properties of 2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+)?
2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+) has a molecular weight of 262.17 g/mol, XLogP of 1.78, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(prop-2-enoxymethyl)butan-1-ol;titanium(3+) is sourced from PubChem (CID 175725412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).