C15H21N3O3 — CID 175725939
3-[4-[N'-[(3S)-piperidin-3-yl]carbamimidoyl]phenoxy]propanoic acid (PubChem CID 175725939) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-[4-[N'-[(3S)-piperidin-3-yl]carbamimidoyl]phenoxy]propanoic acid.
| Compound Name | 3-[4-[N'-[(3S)-piperidin-3-yl]carbamimidoyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 175725939 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-[4-[N'-[(3S)-piperidin-3-yl]carbamimidoyl]phenoxy]propanoic acid |
| SMILES | N/C(=N\[C@H]1CCCNC1)c1ccc(OCCC(=O)O)cc1 |
| InChI | InChI=1S/C15H21N3O3/c16-15(18-12-2-1-8-17-10-12)11-3-5-13(6-4-11)21-9-7-14(19)20/h3-6,12,17H,1-2,7-10H2,(H2,16,18)(H,19,20)/t12-/m0/s1 |
| InChIKey | CSOCGNHVYLKJSL-LBPRGKRZSA-N |
| XLogP | 1.00 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|