About 2-chloroethenyl acetate;ethene
2-chloroethenyl acetate;ethene (PubChem CID 175726418) has the molecular formula C6H9ClO2
and a molecular weight of 148.59 g/mol. Its IUPAC name is 2-chloroethenyl acetate;ethene.
Molecular Properties
| Compound Name | 2-chloroethenyl acetate;ethene |
| PubChem CID | 175726418 |
| Molecular Formula | C6H9ClO2 |
| Molecular Weight | 148.59 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | 2-chloroethenyl acetate;ethene |
| SMILES | C=C.CC(=O)OC=CCl |
| InChI | InChI=1S/C4H5ClO2.C2H4/c1-4(6)7-3-2-5;1-2/h2-3H,1H3;1-2H2 |
| InChIKey | XEDIQYFWXNMKDH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.59 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethenyl acetate;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethenyl acetate;ethene?
The IUPAC name of 2-chloroethenyl acetate;ethene (CID 175726418) is 2-chloroethenyl acetate;ethene.
What is the SMILES notation for 2-chloroethenyl acetate;ethene?
The canonical SMILES for 2-chloroethenyl acetate;ethene is C=C.CC(=O)OC=CCl.
What is the InChIKey of 2-chloroethenyl acetate;ethene?
The InChIKey is XEDIQYFWXNMKDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClO2.C2H4/c1-4(6)7-3-2-5;1-2/h2-3H,1H3;1-2H2.
What are the key properties of 2-chloroethenyl acetate;ethene?
2-chloroethenyl acetate;ethene has a molecular weight of 148.59 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethenyl acetate;ethene is sourced from PubChem (CID 175726418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).