About 2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol
2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol (PubChem CID 175727092) has the molecular formula C14H15ClN4O
and a molecular weight of 290.75 g/mol. Its IUPAC name is 2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol |
| PubChem CID | 175727092 |
| Molecular Formula | C14H15ClN4O |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol |
| SMILES | CC(C)(O)[C@H]1C[C@@H]1c1cc(-c2cncnc2)nnc1Cl |
| InChI | InChI=1S/C14H15ClN4O/c1-14(2,20)11-3-9(11)10-4-12(18-19-13(10)15)8-5-16-7-17-6-8/h4-7,9,11,20H,3H2,1-2H3/t9-,11+/m1/s1 |
| InChIKey | IQCIKQODNWSRER-KOLCDFICSA-N |
| XLogP | 2.46 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol?
The IUPAC name of 2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol (CID 175727092) is 2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol.
What is the SMILES notation for 2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol?
The canonical SMILES for 2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol is CC(C)(O)[C@H]1C[C@@H]1c1cc(-c2cncnc2)nnc1Cl.
What is the InChIKey of 2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol?
The InChIKey is IQCIKQODNWSRER-KOLCDFICSA-N. The full InChI is InChI=1S/C14H15ClN4O/c1-14(2,20)11-3-9(11)10-4-12(18-19-13(10)15)8-5-16-7-17-6-8/h4-7,9,11,20H,3H2,1-2H3/t9-,11+/m1/s1.
What are the key properties of 2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol?
2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol has a molecular weight of 290.75 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2S)-2-(3-chloro-6-pyrimidin-5-ylpyridazin-4-yl)cyclopropyl]propan-2-ol is sourced from PubChem (CID 175727092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).