C20H24ClN5O4 — CID 175727240
2-[(6-chloro-2,3-dihydro-1-benzofuran-3-yl)amino]-4-[7-(hydroxyamino)-7-oxoheptyl]pyrimidine-5-carboxamide (PubChem CID 175727240) has the molecular formula C20H24ClN5O4 and a molecular weight of 433.90 g/mol. Its IUPAC name is 2-[(6-chloro-2,3-dihydro-1-benzofuran-3-yl)amino]-4-[7-(hydroxyamino)-7-oxoheptyl]pyrimidine-5-carboxamide.
| Compound Name | 2-[(6-chloro-2,3-dihydro-1-benzofuran-3-yl)amino]-4-[7-(hydroxyamino)-7-oxoheptyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 175727240 |
| Molecular Formula | C20H24ClN5O4 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-[(6-chloro-2,3-dihydro-1-benzofuran-3-yl)amino]-4-[7-(hydroxyamino)-7-oxoheptyl]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(NC2COc3cc(Cl)ccc32)nc1CCCCCCC(=O)NO |
| InChI | InChI=1S/C20H24ClN5O4/c21-12-7-8-13-16(11-30-17(13)9-12)25-20-23-10-14(19(22)28)15(24-20)5-3-1-2-4-6-18(27)26-29/h7-10,16,29H,1-6,11H2,(H2,22,28)(H,26,27)(H,23,24,25) |
| InChIKey | LJOPLZYHFKSVEK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|