About 2-benzamidoacetic acid;prop-2-enamide
2-benzamidoacetic acid;prop-2-enamide (PubChem CID 175727656) has the molecular formula C12H14N2O4
and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-benzamidoacetic acid;prop-2-enamide.
Molecular Properties
| Compound Name | 2-benzamidoacetic acid;prop-2-enamide |
| PubChem CID | 175727656 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-benzamidoacetic acid;prop-2-enamide |
| SMILES | C=CC(N)=O.O=C(O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H9NO3.C3H5NO/c11-8(12)6-10-9(13)7-4-2-1-3-5-7;1-2-3(4)5/h1-5H,6H2,(H,10,13)(H,11,12);2H,1H2,(H2,4,5) |
| InChIKey | DUCGQZBTHHGCQT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-benzamidoacetic acid;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzamidoacetic acid;prop-2-enamide?
The IUPAC name of 2-benzamidoacetic acid;prop-2-enamide (CID 175727656) is 2-benzamidoacetic acid;prop-2-enamide.
What is the SMILES notation for 2-benzamidoacetic acid;prop-2-enamide?
The canonical SMILES for 2-benzamidoacetic acid;prop-2-enamide is C=CC(N)=O.O=C(O)CNC(=O)c1ccccc1.
What is the InChIKey of 2-benzamidoacetic acid;prop-2-enamide?
The InChIKey is DUCGQZBTHHGCQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3.C3H5NO/c11-8(12)6-10-9(13)7-4-2-1-3-5-7;1-2-3(4)5/h1-5H,6H2,(H,10,13)(H,11,12);2H,1H2,(H2,4,5).
What are the key properties of 2-benzamidoacetic acid;prop-2-enamide?
2-benzamidoacetic acid;prop-2-enamide has a molecular weight of 250.25 g/mol, XLogP of 0.16, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzamidoacetic acid;prop-2-enamide is sourced from PubChem (CID 175727656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).