About iridium(3+);1,5-naphthyridine
iridium(3+);1,5-naphthyridine (PubChem CID 175728214) has the molecular formula C8H6IrN2+3
and a molecular weight of 322.37 g/mol. Its IUPAC name is iridium(3+);1,5-naphthyridine.
Molecular Properties
| Compound Name | iridium(3+);1,5-naphthyridine |
| PubChem CID | 175728214 |
| Molecular Formula | C8H6IrN2+3 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | iridium(3+);1,5-naphthyridine |
| SMILES | [Ir+3].c1cnc2cccnc2c1 |
| InChI | InChI=1S/C8H6N2.Ir/c1-3-7-8(9-5-1)4-2-6-10-7;/h1-6H;/q;+3 |
| InChIKey | CGFBYLHJPOJZDF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze iridium(3+);1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium(3+);1,5-naphthyridine?
The IUPAC name of iridium(3+);1,5-naphthyridine (CID 175728214) is iridium(3+);1,5-naphthyridine.
What is the SMILES notation for iridium(3+);1,5-naphthyridine?
The canonical SMILES for iridium(3+);1,5-naphthyridine is [Ir+3].c1cnc2cccnc2c1.
What is the InChIKey of iridium(3+);1,5-naphthyridine?
The InChIKey is CGFBYLHJPOJZDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.Ir/c1-3-7-8(9-5-1)4-2-6-10-7;/h1-6H;/q;+3.
What are the key properties of iridium(3+);1,5-naphthyridine?
iridium(3+);1,5-naphthyridine has a molecular weight of 322.37 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iridium(3+);1,5-naphthyridine is sourced from PubChem (CID 175728214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).