C28H26FN5O2 — CID 175728517
[3-[4-(1,2-benzoxazol-3-yl)-1H-pyrrol-3-yl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-10-yl]-piperidin-1-ylmethanone (PubChem CID 175728517) has the molecular formula C28H26FN5O2 and a molecular weight of 483.55 g/mol. Its IUPAC name is [3-[4-(1,2-benzoxazol-3-yl)-1H-pyrrol-3-yl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-10-yl]-piperidin-1-ylmethanone.
| Compound Name | [3-[4-(1,2-benzoxazol-3-yl)-1H-pyrrol-3-yl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-10-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 175728517 |
| Molecular Formula | C28H26FN5O2 |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | [3-[4-(1,2-benzoxazol-3-yl)-1H-pyrrol-3-yl]-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-10-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(N1CCCCC1)N1CCn2cc(-c3c[nH]cc3-c3noc4ccccc34)c3cc(F)cc(c32)C1 |
| InChI | InChI=1S/C28H26FN5O2/c29-19-12-18-16-34(28(35)32-8-4-1-5-9-32)11-10-33-17-24(21(13-19)27(18)33)22-14-30-15-23(22)26-20-6-2-3-7-25(20)36-31-26/h2-3,6-7,12-15,17,30H,1,4-5,8-11,16H2 |
| InChIKey | BBIXXQKRPMBCCI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |