About 2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene
2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene (PubChem CID 175728992) has the molecular formula C15H16Cl2O
and a molecular weight of 283.20 g/mol. Its IUPAC name is 2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene.
Molecular Properties
| Compound Name | 2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene |
| PubChem CID | 175728992 |
| Molecular Formula | C15H16Cl2O |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene |
| SMILES | CC(C)(C)C1=C(Oc2c(Cl)cccc2Cl)CC=C1 |
| InChI | InChI=1S/C15H16Cl2O/c1-15(2,3)10-6-4-9-13(10)18-14-11(16)7-5-8-12(14)17/h4-8H,9H2,1-3H3 |
| InChIKey | RUMJCIPTIKQEJM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene?
The IUPAC name of 2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene (CID 175728992) is 2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene.
What is the SMILES notation for 2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene?
The canonical SMILES for 2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene is CC(C)(C)C1=C(Oc2c(Cl)cccc2Cl)CC=C1.
What is the InChIKey of 2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene?
The InChIKey is RUMJCIPTIKQEJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2O/c1-15(2,3)10-6-4-9-13(10)18-14-11(16)7-5-8-12(14)17/h4-8H,9H2,1-3H3.
What are the key properties of 2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene?
2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene has a molecular weight of 283.20 g/mol, XLogP of 5.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-tert-butylcyclopenta-1,3-dien-1-yl)oxy-1,3-dichlorobenzene is sourced from PubChem (CID 175728992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).