About ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate
ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate (PubChem CID 175729291) has the molecular formula C9H12N2O3S
and a molecular weight of 228.27 g/mol. Its IUPAC name is ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate |
| PubChem CID | 175729291 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1N1CC(O)C1 |
| InChI | InChI=1S/C9H12N2O3S/c1-2-14-9(13)7-8(15-5-10-7)11-3-6(12)4-11/h5-6,12H,2-4H2,1H3 |
| InChIKey | HDMQVWLMLQNXKE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate (CID 175729291) is ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate is CCOC(=O)c1ncsc1N1CC(O)C1.
What is the InChIKey of ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate?
The InChIKey is HDMQVWLMLQNXKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S/c1-2-14-9(13)7-8(15-5-10-7)11-3-6(12)4-11/h5-6,12H,2-4H2,1H3.
What are the key properties of ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate?
ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate has a molecular weight of 228.27 g/mol, XLogP of 0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(3-hydroxyazetidin-1-yl)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 175729291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).